C16H31N3O4 — CID 145353862
2-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]ethyl 2-(2-aminoethyl)-2,3,3-trimethylbutanoate (PubChem CID 145353862) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]ethyl 2-(2-aminoethyl)-2,3,3-trimethylbutanoate.
| Compound Name | 2-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]ethyl 2-(2-aminoethyl)-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 145353862 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 2-[[(Z)-butan-2-ylideneamino]oxycarbonylamino]ethyl 2-(2-aminoethyl)-2,3,3-trimethylbutanoate |
| SMILES | CC/C(C)=N\OC(=O)NCCOC(=O)C(C)(CCN)C(C)(C)C |
| InChI | InChI=1S/C16H31N3O4/c1-7-12(2)19-23-14(21)18-10-11-22-13(20)16(6,8-9-17)15(3,4)5/h7-11,17H2,1-6H3,(H,18,21)/b19-12- |
| InChIKey | QXDIHINQTVKUPE-UNOMPAQXSA-N |
| XLogP | 2.44 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|