C20H34 — CID 145357305
4,11-dimethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane;ethane;prop-1-ene (PubChem CID 145357305) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 4,11-dimethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane;ethane;prop-1-ene.
| Compound Name | 4,11-dimethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane;ethane;prop-1-ene |
|---|---|
| PubChem CID | 145357305 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 4,11-dimethylpentacyclo[7.4.0.02,7.03,6.010,13]tridecane;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC1CC2C1C1CC3C4CC(C)C4C3C21 |
| InChI | InChI=1S/C15H22.C3H6.C2H6/c1-6-4-10-12(6)11-5-9-8-3-7(2)13(8)15(9)14(10)11;1-3-2;1-2/h6-15H,3-5H2,1-2H3;3H,1H2,2H3;1-2H3 |
| InChIKey | PZMJGMYKZBGHPK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|