C11H19NO — CID 145358744
N-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]propan-2-amine (PubChem CID 145358744) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]propan-2-amine.
| Compound Name | N-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]propan-2-amine |
|---|---|
| PubChem CID | 145358744 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]propan-2-amine |
| SMILES | C=C/C=C(\C=C)OCCNC(C)C |
| InChI | InChI=1S/C11H19NO/c1-5-7-11(6-2)13-9-8-12-10(3)4/h5-7,10,12H,1-2,8-9H2,3-4H3/b11-7+ |
| InChIKey | NLAYDZJTSOPVIO-YRNVUSSQSA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|