C10H11N3 — CID 145358965
8-ethyl-5-methylpyrido[3,4-b]pyrazine (PubChem CID 145358965) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 8-ethyl-5-methylpyrido[3,4-b]pyrazine.
| Compound Name | 8-ethyl-5-methylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 145358965 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 8-ethyl-5-methylpyrido[3,4-b]pyrazine |
| SMILES | CCc1cnc(C)c2nccnc12 |
| InChI | InChI=1S/C10H11N3/c1-3-8-6-13-7(2)9-10(8)12-5-4-11-9/h4-6H,3H2,1-2H3 |
| InChIKey | BNWLYUURIAZAFG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |