C10H13NO2 — CID 163884675
carbon dioxide;3-ethyl-2,5-dimethylpyridine (PubChem CID 163884675) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is carbon dioxide;3-ethyl-2,5-dimethylpyridine.
| Compound Name | carbon dioxide;3-ethyl-2,5-dimethylpyridine |
|---|---|
| PubChem CID | 163884675 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | carbon dioxide;3-ethyl-2,5-dimethylpyridine |
| SMILES | CCc1cc(C)cnc1C.O=C=O |
| InChI | InChI=1S/C9H13N.CO2/c1-4-9-5-7(2)6-10-8(9)3;2-1-3/h5-6H,4H2,1-3H3; |
| InChIKey | PWHYMDAHWIUYER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |