C15H14N2O3S — CID 145360332
(Z)-3-(3-anilinosulfanylphenyl)-N,2-dihydroxyprop-2-enamide (PubChem CID 145360332) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is (Z)-3-(3-anilinosulfanylphenyl)-N,2-dihydroxyprop-2-enamide.
| Compound Name | (Z)-3-(3-anilinosulfanylphenyl)-N,2-dihydroxyprop-2-enamide |
|---|---|
| PubChem CID | 145360332 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (Z)-3-(3-anilinosulfanylphenyl)-N,2-dihydroxyprop-2-enamide |
| SMILES | O=C(NO)/C(O)=C/c1cccc(SNc2ccccc2)c1 |
| InChI | InChI=1S/C15H14N2O3S/c18-14(15(19)16-20)10-11-5-4-8-13(9-11)21-17-12-6-2-1-3-7-12/h1-10,17-18,20H,(H,16,19)/b14-10- |
| InChIKey | MUQSGEMFAQEZCT-UVTDQMKNSA-N |
| XLogP | 3.21 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|