C21H21BrN2OS — CID 170977109
N-[3-(4-bromoanilino)sulfanylphenyl]formamide;1,4-xylene (PubChem CID 170977109) has the molecular formula C21H21BrN2OS and a molecular weight of 429.38 g/mol. Its IUPAC name is N-[3-(4-bromoanilino)sulfanylphenyl]formamide;1,4-xylene.
| Compound Name | N-[3-(4-bromoanilino)sulfanylphenyl]formamide;1,4-xylene |
|---|---|
| PubChem CID | 170977109 |
| Molecular Formula | C21H21BrN2OS |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[3-(4-bromoanilino)sulfanylphenyl]formamide;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.O=CNc1cccc(SNc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C13H11BrN2OS.C8H10/c14-10-4-6-11(7-5-10)16-18-13-3-1-2-12(8-13)15-9-17;1-7-3-5-8(2)6-4-7/h1-9,16H,(H,15,17);3-6H,1-2H3 |
| InChIKey | OOVWGVDCYCTUEI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|