C19H21F3N4OS — CID 156859899
N-methyl-3-(4-methylanilino)sulfanylaniline;2,2,2-trifluoro-N'-[(E)-3-oxoprop-1-enyl]ethanimidamide (PubChem CID 156859899) has the molecular formula C19H21F3N4OS and a molecular weight of 410.47 g/mol. Its IUPAC name is N-methyl-3-(4-methylanilino)sulfanylaniline;2,2,2-trifluoro-N'-[(E)-3-oxoprop-1-enyl]ethanimidamide.
| Compound Name | N-methyl-3-(4-methylanilino)sulfanylaniline;2,2,2-trifluoro-N'-[(E)-3-oxoprop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 156859899 |
| Molecular Formula | C19H21F3N4OS |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-methyl-3-(4-methylanilino)sulfanylaniline;2,2,2-trifluoro-N'-[(E)-3-oxoprop-1-enyl]ethanimidamide |
| SMILES | CNc1cccc(SNc2ccc(C)cc2)c1.N/C(=N\C=C\C=O)C(F)(F)F |
| InChI | InChI=1S/C14H16N2S.C5H5F3N2O/c1-11-6-8-12(9-7-11)16-17-14-5-3-4-13(10-14)15-2;6-5(7,8)4(9)10-2-1-3-11/h3-10,15-16H,1-2H3;1-3H,(H2,9,10)/b;2-1+ |
| InChIKey | OZVIVBRTPSXTLS-WLHGVMLRSA-N |
| XLogP | 4.77 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|