C15H15ClN4O — CID 145360454
(5Z)-13-chloro-5-ethylidene-7-[(Z)-prop-1-enyl]-2,9,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),6,10,12-tetraen-8-one (PubChem CID 145360454) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is (5Z)-13-chloro-5-ethylidene-7-[(Z)-prop-1-enyl]-2,9,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),6,10,12-tetraen-8-one.
| Compound Name | (5Z)-13-chloro-5-ethylidene-7-[(Z)-prop-1-enyl]-2,9,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),6,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 145360454 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (5Z)-13-chloro-5-ethylidene-7-[(Z)-prop-1-enyl]-2,9,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),6,10,12-tetraen-8-one |
| SMILES | C/C=C\C1=C2/C(=C\C)CCN2c2nc(Cl)ncc2NC1=O |
| InChI | InChI=1S/C15H15ClN4O/c1-3-5-10-12-9(4-2)6-7-20(12)13-11(18-14(10)21)8-17-15(16)19-13/h3-5,8H,6-7H2,1-2H3,(H,18,21)/b5-3-,9-4- |
| InChIKey | YFLWQKCHPUXHFK-SIJZXUBCSA-N |
| XLogP | 3.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |