C10H11ClN4O2 — CID 90368268
2-chloro-8-(3-hydroxypropyl)-7-methylidene-5H-pteridin-6-one (PubChem CID 90368268) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is 2-chloro-8-(3-hydroxypropyl)-7-methylidene-5H-pteridin-6-one.
| Compound Name | 2-chloro-8-(3-hydroxypropyl)-7-methylidene-5H-pteridin-6-one |
|---|---|
| PubChem CID | 90368268 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-chloro-8-(3-hydroxypropyl)-7-methylidene-5H-pteridin-6-one |
| SMILES | C=C1C(=O)Nc2cnc(Cl)nc2N1CCCO |
| InChI | InChI=1S/C10H11ClN4O2/c1-6-9(17)13-7-5-12-10(11)14-8(7)15(6)3-2-4-16/h5,16H,1-4H2,(H,13,17) |
| InChIKey | CLAOTIWCMWPWSX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|