C13H18ClN3O — CID 87631727
2-chloro-5,5-dimethyl-7-pentylpyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 87631727) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-chloro-5,5-dimethyl-7-pentylpyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-chloro-5,5-dimethyl-7-pentylpyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 87631727 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-chloro-5,5-dimethyl-7-pentylpyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCCN1C(=O)C(C)(C)c2cnc(Cl)nc21 |
| InChI | InChI=1S/C13H18ClN3O/c1-4-5-6-7-17-10-9(8-15-12(14)16-10)13(2,3)11(17)18/h8H,4-7H2,1-3H3 |
| InChIKey | CJUBEWDQHHIXPJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|