C26H33N3O — CID 59300787
1-ethyl-7,7-dimethyl-5-pentyl-2-(2-phenylethyl)pyrrolo[2,3-f]benzimidazol-6-one (PubChem CID 59300787) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-ethyl-7,7-dimethyl-5-pentyl-2-(2-phenylethyl)pyrrolo[2,3-f]benzimidazol-6-one.
| Compound Name | 1-ethyl-7,7-dimethyl-5-pentyl-2-(2-phenylethyl)pyrrolo[2,3-f]benzimidazol-6-one |
|---|---|
| PubChem CID | 59300787 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-ethyl-7,7-dimethyl-5-pentyl-2-(2-phenylethyl)pyrrolo[2,3-f]benzimidazol-6-one |
| SMILES | CCCCCN1C(=O)C(C)(C)c2cc3c(cc21)nc(CCc1ccccc1)n3CC |
| InChI | InChI=1S/C26H33N3O/c1-5-7-11-16-29-22-18-21-23(17-20(22)26(3,4)25(29)30)28(6-2)24(27-21)15-14-19-12-9-8-10-13-19/h8-10,12-13,17-18H,5-7,11,14-16H2,1-4H3 |
| InChIKey | MFPARMZAZZMCOH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|