C10H5ClF3N5OS — CID 155287349
13-chloro-2-methyl-5-(trifluoromethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 155287349) has the molecular formula C10H5ClF3N5OS and a molecular weight of 335.70 g/mol. Its IUPAC name is 13-chloro-2-methyl-5-(trifluoromethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 13-chloro-2-methyl-5-(trifluoromethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 155287349 |
| Molecular Formula | C10H5ClF3N5OS |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 13-chloro-2-methyl-5-(trifluoromethyl)-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | CN1c2nc(Cl)ncc2NC(=O)c2nc(C(F)(F)F)sc21 |
| InChI | InChI=1S/C10H5ClF3N5OS/c1-19-5-3(2-15-9(11)18-5)16-6(20)4-7(19)21-8(17-4)10(12,13)14/h2H,1H3,(H,16,20) |
| InChIKey | JNLJNCRPMLEHQN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |