C12H11NS — CID 145360943
2,3-dihydrodibenzothiophen-4-amine (PubChem CID 145360943) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2,3-dihydrodibenzothiophen-4-amine.
| Compound Name | 2,3-dihydrodibenzothiophen-4-amine |
|---|---|
| PubChem CID | 145360943 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2,3-dihydrodibenzothiophen-4-amine |
| SMILES | NC1=c2sc3ccccc3c2=CCC1 |
| InChI | InChI=1S/C12H11NS/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-2,4-5,7H,3,6,13H2 |
| InChIKey | ZDMYLHUVJRGGJW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |