C21H30N6O — CID 145364265
N'-(methyliminomethyl)-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-propan-2-ylindole-5-carboximidamide (PubChem CID 145364265) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is N'-(methyliminomethyl)-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-propan-2-ylindole-5-carboximidamide.
| Compound Name | N'-(methyliminomethyl)-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-propan-2-ylindole-5-carboximidamide |
|---|---|
| PubChem CID | 145364265 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | N'-(methyliminomethyl)-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-3-propan-2-ylindole-5-carboximidamide |
| SMILES | C/N=C/N=C(\N)c1ccc2c(c1)c(C(C)C)cn2CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H30N6O/c1-15(2)18-12-27(13-20(28)26-9-7-25(4)8-10-26)19-6-5-16(11-17(18)19)21(22)24-14-23-3/h5-6,11-12,14-15H,7-10,13H2,1-4H3,(H2,22,23,24) |
| InChIKey | QEKRLAWCQNGIJW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|