C27H39N5O3 — CID 145364902
(1Z)-1-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-3-[4-(5-hexoxybenzimidazol-1-yl)phenyl]urea;molecular hydrogen (PubChem CID 145364902) has the molecular formula C27H39N5O3 and a molecular weight of 481.64 g/mol. Its IUPAC name is (1Z)-1-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-3-[4-(5-hexoxybenzimidazol-1-yl)phenyl]urea;molecular hydrogen.
| Compound Name | (1Z)-1-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-3-[4-(5-hexoxybenzimidazol-1-yl)phenyl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 145364902 |
| Molecular Formula | C27H39N5O3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | (1Z)-1-[(Z)-1-amino-3-hydroxy-4,4-dimethylpent-2-enylidene]-3-[4-(5-hexoxybenzimidazol-1-yl)phenyl]urea;molecular hydrogen |
| SMILES | CCCCCCOc1ccc2c(c1)ncn2-c1ccc(NC(=O)/N=C(N)/C=C(\O)C(C)(C)C)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C27H35N5O3.2H2/c1-5-6-7-8-15-35-21-13-14-23-22(16-21)29-18-32(23)20-11-9-19(10-12-20)30-26(34)31-25(28)17-24(33)27(2,3)4;;/h9-14,16-18,33H,5-8,15H2,1-4H3,(H3,28,30,31,34);2*1H/b24-17-;; |
| InChIKey | LDTUXYPFNMXQEC-PQEMCYEJSA-N |
| XLogP | 6.85 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|