C23H31NO4 — CID 145365758
4-[[4-[(4-formylcyclohexyl)methoxy]-3-methanimidoylphenoxy]methyl]cyclohexane-1-carbaldehyde (PubChem CID 145365758) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-[[4-[(4-formylcyclohexyl)methoxy]-3-methanimidoylphenoxy]methyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[[4-[(4-formylcyclohexyl)methoxy]-3-methanimidoylphenoxy]methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 145365758 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-[[4-[(4-formylcyclohexyl)methoxy]-3-methanimidoylphenoxy]methyl]cyclohexane-1-carbaldehyde |
| SMILES | [H]/N=C/c1cc(OCC2CCC(C=O)CC2)ccc1OCC1CCC(C=O)CC1 |
| InChI | InChI=1S/C23H31NO4/c24-12-21-11-22(27-15-19-5-1-17(13-25)2-6-19)9-10-23(21)28-16-20-7-3-18(14-26)4-8-20/h9-14,17-20,24H,1-8,15-16H2/b24-12+ |
| InChIKey | AHTGPIDAPVWDQK-WYMPLXKRSA-N |
| XLogP | 4.45 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|