C61H61BFN2O+ — CID 145366105
4,6,10,12-tetrakis(4-tert-butylphenyl)-8-dibenzofuran-4-yl-2-fluoro-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 145366105) has the molecular formula C61H61BFN2O+ and a molecular weight of 867.98 g/mol. Its IUPAC name is 4,6,10,12-tetrakis(4-tert-butylphenyl)-8-dibenzofuran-4-yl-2-fluoro-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,6,10,12-tetrakis(4-tert-butylphenyl)-8-dibenzofuran-4-yl-2-fluoro-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 145366105 |
| Molecular Formula | C61H61BFN2O+ |
| Molecular Weight | 867.98 g/mol |
| Exact Mass | 867.49 |
| IUPAC Name | 4,6,10,12-tetrakis(4-tert-butylphenyl)-8-dibenzofuran-4-yl-2-fluoro-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC(C)(C)c1ccc(C2=CC(c3ccc(C(C)(C)C)cc3)=[N+]3B(F)n4c(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4C(c4cccc5c4oc4ccccc45)=C23)cc1 |
| InChI | InChI=1S/C61H61BFN2O/c1-58(2,3)42-28-20-38(21-29-42)49-36-51(40-24-32-44(33-25-40)60(7,8)9)64-55(49)54(48-18-15-17-47-46-16-13-14-19-53(46)66-57(47)48)56-50(39-22-30-43(31-23-39)59(4,5)6)37-52(65(56)62(64)63)41-26-34-45(35-27-41)61(10,11)12/h13-37H,1-12H3/q+1 |
| InChIKey | HYKQGGRYWBOLIT-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 21.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.98 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|