C42H27BFN2O2+ — CID 154692893
5-(2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)chromen-2-one (PubChem CID 154692893) has the molecular formula C42H27BFN2O2+ and a molecular weight of 621.50 g/mol. Its IUPAC name is 5-(2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)chromen-2-one.
| Compound Name | 5-(2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)chromen-2-one |
|---|---|
| PubChem CID | 154692893 |
| Molecular Formula | C42H27BFN2O2+ |
| Molecular Weight | 621.50 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | 5-(2-fluoro-4,6,10,12-tetraphenyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)chromen-2-one |
| SMILES | O=c1ccc2c(C3=C4C(c5ccccc5)=CC(c5ccccc5)=[N+]4B(F)n4c(-c5ccccc5)cc(-c5ccccc5)c43)cccc2o1 |
| InChI | InChI=1S/C42H27BFN2O2/c44-43-45-36(30-18-9-3-10-19-30)26-34(28-14-5-1-6-15-28)41(45)40(33-22-13-23-38-32(33)24-25-39(47)48-38)42-35(29-16-7-2-8-17-29)27-37(46(42)43)31-20-11-4-12-21-31/h1-27H/q+1 |
| InChIKey | VJNKDWKBGNPGCX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 38.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.50 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|