C23H26Cl2N4O2S — CID 145367412
4,5-dichloro-1,2-dimethylindole;N-(3-formamido-3-phenylpyrrolidin-1-yl)sulfanylacetamide (PubChem CID 145367412) has the molecular formula C23H26Cl2N4O2S and a molecular weight of 493.46 g/mol. Its IUPAC name is 4,5-dichloro-1,2-dimethylindole;N-(3-formamido-3-phenylpyrrolidin-1-yl)sulfanylacetamide.
| Compound Name | 4,5-dichloro-1,2-dimethylindole;N-(3-formamido-3-phenylpyrrolidin-1-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 145367412 |
| Molecular Formula | C23H26Cl2N4O2S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 4,5-dichloro-1,2-dimethylindole;N-(3-formamido-3-phenylpyrrolidin-1-yl)sulfanylacetamide |
| SMILES | CC(=O)NSN1CCC(NC=O)(c2ccccc2)C1.Cc1cc2c(Cl)c(Cl)ccc2n1C |
| InChI | InChI=1S/C13H17N3O2S.C10H9Cl2N/c1-11(18)15-19-16-8-7-13(9-16,14-10-17)12-5-3-2-4-6-12;1-6-5-7-9(13(6)2)4-3-8(11)10(7)12/h2-6,10H,7-9H2,1H3,(H,14,17)(H,15,18);3-5H,1-2H3 |
| InChIKey | GCZLXOISPIFAMN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|