C19H18ClFN4O3S — CID 145367735
4-chloro-5-fluoro-N-[5-[(2-hydroxy-2-methylpropanoyl)amino]sulfanyl-2-pyridinyl]-1-methylindole-2-carboxamide (PubChem CID 145367735) has the molecular formula C19H18ClFN4O3S and a molecular weight of 436.90 g/mol. Its IUPAC name is 4-chloro-5-fluoro-N-[5-[(2-hydroxy-2-methylpropanoyl)amino]sulfanyl-2-pyridinyl]-1-methylindole-2-carboxamide.
| Compound Name | 4-chloro-5-fluoro-N-[5-[(2-hydroxy-2-methylpropanoyl)amino]sulfanyl-2-pyridinyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 145367735 |
| Molecular Formula | C19H18ClFN4O3S |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 4-chloro-5-fluoro-N-[5-[(2-hydroxy-2-methylpropanoyl)amino]sulfanyl-2-pyridinyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(SNC(=O)C(C)(C)O)cn2)cc2c(Cl)c(F)ccc21 |
| InChI | InChI=1S/C19H18ClFN4O3S/c1-19(2,28)18(27)24-29-10-4-7-15(22-9-10)23-17(26)14-8-11-13(25(14)3)6-5-12(21)16(11)20/h4-9,28H,1-3H3,(H,24,27)(H,22,23,26) |
| InChIKey | OMUXMACBIQLOAM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|