C12H12N4OS — CID 145367834
N-(4-aminophenyl)sulfanyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine (PubChem CID 145367834) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfanyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine.
| Compound Name | N-(4-aminophenyl)sulfanyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145367834 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-(4-aminophenyl)sulfanyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine |
| SMILES | Nc1ccc(SNc2ncc3c(n2)COC3)cc1 |
| InChI | InChI=1S/C12H12N4OS/c13-9-1-3-10(4-2-9)18-16-12-14-5-8-6-17-7-11(8)15-12/h1-5H,6-7,13H2,(H,14,15,16) |
| InChIKey | RSYACSIKZLMGAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|