C13H17N5S — CID 143598378
4-N-(4-aminophenyl)sulfanyl-2-N,6-N-dimethylpyridine-2,4,6-triamine (PubChem CID 143598378) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)sulfanyl-2-N,6-N-dimethylpyridine-2,4,6-triamine.
| Compound Name | 4-N-(4-aminophenyl)sulfanyl-2-N,6-N-dimethylpyridine-2,4,6-triamine |
|---|---|
| PubChem CID | 143598378 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-N-(4-aminophenyl)sulfanyl-2-N,6-N-dimethylpyridine-2,4,6-triamine |
| SMILES | CNc1cc(NSc2ccc(N)cc2)cc(NC)n1 |
| InChI | InChI=1S/C13H17N5S/c1-15-12-7-10(8-13(16-2)17-12)18-19-11-5-3-9(14)4-6-11/h3-8H,14H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | UWMYJOOIWIVOIS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|