C11H20O — CID 145370070
3',6-dimethylspiro[bicyclo[2.2.0]hexane-2,2'-oxirane];ethane (PubChem CID 145370070) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 3',6-dimethylspiro[bicyclo[2.2.0]hexane-2,2'-oxirane];ethane.
| Compound Name | 3',6-dimethylspiro[bicyclo[2.2.0]hexane-2,2'-oxirane];ethane |
|---|---|
| PubChem CID | 145370070 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3',6-dimethylspiro[bicyclo[2.2.0]hexane-2,2'-oxirane];ethane |
| SMILES | CC.CC1CC2CC3(OC3C)C12 |
| InChI | InChI=1S/C9H14O.C2H6/c1-5-3-7-4-9(8(5)7)6(2)10-9;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | RGCVRRANRGRJCC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|