C10H21N — CID 145385716
ethane;1-ethyl-4-methyl-3,4-dihydro-2H-pyridine (PubChem CID 145385716) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is ethane;1-ethyl-4-methyl-3,4-dihydro-2H-pyridine.
| Compound Name | ethane;1-ethyl-4-methyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 145385716 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | ethane;1-ethyl-4-methyl-3,4-dihydro-2H-pyridine |
| SMILES | CC.CCN1C=CC(C)CC1 |
| InChI | InChI=1S/C8H15N.C2H6/c1-3-9-6-4-8(2)5-7-9;1-2/h4,6,8H,3,5,7H2,1-2H3;1-2H3 |
| InChIKey | QJFOMBPOZBFKIF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |