C17H13N5OS — CID 145386186
N-(6-methoxy-3-pyridinyl)-4-quinazolin-2-yl-1,3-thiazol-2-amine (PubChem CID 145386186) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-4-quinazolin-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(6-methoxy-3-pyridinyl)-4-quinazolin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145386186 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-4-quinazolin-2-yl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3ncc4ccccc4n3)cs2)cn1 |
| InChI | InChI=1S/C17H13N5OS/c1-23-15-7-6-12(9-18-15)20-17-22-14(10-24-17)16-19-8-11-4-2-3-5-13(11)21-16/h2-10H,1H3,(H,20,22) |
| InChIKey | YSHNCMLCBZVXAG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |