C15H26N2O4S — CID 145387625
ethane;3-(2-hydroxypropan-2-yl)-5-morpholin-4-ylbenzenesulfonamide (PubChem CID 145387625) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is ethane;3-(2-hydroxypropan-2-yl)-5-morpholin-4-ylbenzenesulfonamide.
| Compound Name | ethane;3-(2-hydroxypropan-2-yl)-5-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 145387625 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethane;3-(2-hydroxypropan-2-yl)-5-morpholin-4-ylbenzenesulfonamide |
| SMILES | CC.CC(C)(O)c1cc(N2CCOCC2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H20N2O4S.C2H6/c1-13(2,16)10-7-11(15-3-5-19-6-4-15)9-12(8-10)20(14,17)18;1-2/h7-9,16H,3-6H2,1-2H3,(H2,14,17,18);1-2H3 |
| InChIKey | NMISXXAWPPCXMA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |