C32H22F6OSi — CID 145389449
2-[6-[[4-[2-(4-ethenylphenyl)ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,3-difluoronaphthalen-2-yl]ethynyl-trimethylsilane (PubChem CID 145389449) has the molecular formula C32H22F6OSi and a molecular weight of 564.60 g/mol. Its IUPAC name is 2-[6-[[4-[2-(4-ethenylphenyl)ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,3-difluoronaphthalen-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[6-[[4-[2-(4-ethenylphenyl)ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,3-difluoronaphthalen-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 145389449 |
| Molecular Formula | C32H22F6OSi |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 2-[6-[[4-[2-(4-ethenylphenyl)ethynyl]-2,6-difluorophenyl]-difluoromethoxy]-1,3-difluoronaphthalen-2-yl]ethynyl-trimethylsilane |
| SMILES | C=Cc1ccc(C#Cc2cc(F)c(C(F)(F)Oc3ccc4c(F)c(C#C[Si](C)(C)C)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C32H22F6OSi/c1-5-20-6-8-21(9-7-20)10-11-22-16-28(34)30(29(35)17-22)32(37,38)39-24-12-13-25-23(18-24)19-27(33)26(31(25)36)14-15-40(2,3)4/h5-9,12-13,16-19H,1H2,2-4H3 |
| InChIKey | YUZPQNUELLTQMQ-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|