C10H28N2 — CID 145389769
ethane;1-N-ethylpropane-1,2-diamine;propane (PubChem CID 145389769) has the molecular formula C10H28N2 and a molecular weight of 176.35 g/mol. Its IUPAC name is ethane;1-N-ethylpropane-1,2-diamine;propane.
| Compound Name | ethane;1-N-ethylpropane-1,2-diamine;propane |
|---|---|
| PubChem CID | 145389769 |
| Molecular Formula | C10H28N2 |
| Molecular Weight | 176.35 g/mol |
| Exact Mass | 176.23 |
| IUPAC Name | ethane;1-N-ethylpropane-1,2-diamine;propane |
| SMILES | CC.CCC.CCNCC(C)N |
| InChI | InChI=1S/C5H14N2.C3H8.C2H6/c1-3-7-4-5(2)6;1-3-2;1-2/h5,7H,3-4,6H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | KDZQGPHENZPCJC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |