C24H39N3O11S — CID 145391029
3-[(3-aminooxy-3-oxopropyl)-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoyl]amino]propanethioic S-acid;pyrrolidine-2,5-dione (PubChem CID 145391029) has the molecular formula C24H39N3O11S and a molecular weight of 577.65 g/mol. Its IUPAC name is 3-[(3-aminooxy-3-oxopropyl)-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoyl]amino]propanethioic S-acid;pyrrolidine-2,5-dione.
| Compound Name | 3-[(3-aminooxy-3-oxopropyl)-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoyl]amino]propanethioic S-acid;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145391029 |
| Molecular Formula | C24H39N3O11S |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 3-[(3-aminooxy-3-oxopropyl)-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoyl]amino]propanethioic S-acid;pyrrolidine-2,5-dione |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)N(CCC(=O)S)CCC(=O)ON.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C20H34N2O9S.C4H5NO2/c1-2-8-26-10-12-28-14-16-30-17-15-29-13-11-27-9-5-18(23)22(7-4-20(25)32)6-3-19(24)31-21;6-3-1-2-4(7)5-3/h1H,3-17,21H2,(H,25,32);1-2H2,(H,5,6,7) |
| InChIKey | DZMMIGQHDUNCTE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|