C29H25FN2O2S2 — CID 145391223
(4E)-N-benzyl-3-benzylsulfanyl-6-(4-fluorophenyl)-4-hydroxyimino-6,7-dihydro-5H-2-benzothiophene-1-carboxamide (PubChem CID 145391223) has the molecular formula C29H25FN2O2S2 and a molecular weight of 516.66 g/mol. Its IUPAC name is (4E)-N-benzyl-3-benzylsulfanyl-6-(4-fluorophenyl)-4-hydroxyimino-6,7-dihydro-5H-2-benzothiophene-1-carboxamide.
| Compound Name | (4E)-N-benzyl-3-benzylsulfanyl-6-(4-fluorophenyl)-4-hydroxyimino-6,7-dihydro-5H-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 145391223 |
| Molecular Formula | C29H25FN2O2S2 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | (4E)-N-benzyl-3-benzylsulfanyl-6-(4-fluorophenyl)-4-hydroxyimino-6,7-dihydro-5H-2-benzothiophene-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1sc(SCc2ccccc2)c2c1CC(c1ccc(F)cc1)C/C2=N\O |
| InChI | InChI=1S/C29H25FN2O2S2/c30-23-13-11-21(12-14-23)22-15-24-26(25(16-22)32-34)29(35-18-20-9-5-2-6-10-20)36-27(24)28(33)31-17-19-7-3-1-4-8-19/h1-14,22,34H,15-18H2,(H,31,33)/b32-25+ |
| InChIKey | QEZPAXDFZANCEZ-WGPBWIAQSA-N |
| XLogP | 7.02 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|