About 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane
2,4-difluoro-1-methylbenzene;ethane;pentylphosphane (PubChem CID 145391519) has the molecular formula C14H25F2P
and a molecular weight of 262.32 g/mol. Its IUPAC name is 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane.
Molecular Properties
| Compound Name | 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane |
| PubChem CID | 145391519 |
| Molecular Formula | C14H25F2P |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane |
| SMILES | CC.CCCCCP.Cc1ccc(F)cc1F |
| InChI | InChI=1S/C7H6F2.C5H13P.C2H6/c1-5-2-3-6(8)4-7(5)9;1-2-3-4-5-6;1-2/h2-4H,1H3;2-6H2,1H3;1-2H3 |
| InChIKey | IOTWRBAONUANLJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane?
The IUPAC name of 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane (CID 145391519) is 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane.
What is the SMILES notation for 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane?
The canonical SMILES for 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane is CC.CCCCCP.Cc1ccc(F)cc1F.
What is the InChIKey of 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane?
The InChIKey is IOTWRBAONUANLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2.C5H13P.C2H6/c1-5-2-3-6(8)4-7(5)9;1-2-3-4-5-6;1-2/h2-4H,1H3;2-6H2,1H3;1-2H3.
What are the key properties of 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane?
2,4-difluoro-1-methylbenzene;ethane;pentylphosphane has a molecular weight of 262.32 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane is sourced from PubChem (CID 145391519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).