C14H25F2P — CID 145391519
2,4-difluoro-1-methylbenzene;ethane;pentylphosphane (PubChem CID 145391519) has the molecular formula C14H25F2P and a molecular weight of 262.32 g/mol. Its IUPAC name is 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane.
| Compound Name | 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane |
|---|---|
| PubChem CID | 145391519 |
| Molecular Formula | C14H25F2P |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2,4-difluoro-1-methylbenzene;ethane;pentylphosphane |
| SMILES | CC.CCCCCP.Cc1ccc(F)cc1F |
| InChI | InChI=1S/C7H6F2.C5H13P.C2H6/c1-5-2-3-6(8)4-7(5)9;1-2-3-4-5-6;1-2/h2-4H,1H3;2-6H2,1H3;1-2H3 |
| InChIKey | IOTWRBAONUANLJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|