C12H11ClFN3O4 — CID 145393301
4-amino-1-[(3R,5S)-4-chloro-4-ethynyl-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidin-2-one (PubChem CID 145393301) has the molecular formula C12H11ClFN3O4 and a molecular weight of 315.69 g/mol. Its IUPAC name is 4-amino-1-[(3R,5S)-4-chloro-4-ethynyl-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[(3R,5S)-4-chloro-4-ethynyl-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 145393301 |
| Molecular Formula | C12H11ClFN3O4 |
| Molecular Weight | 315.69 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-amino-1-[(3R,5S)-4-chloro-4-ethynyl-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidin-2-one |
| SMILES | C#CC1(Cl)C2OC2([C@@H](C)O)O[C@H]1n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C12H11ClFN3O4/c1-3-11(13)8-12(20-8,5(2)18)21-9(11)17-4-6(14)7(15)16-10(17)19/h1,4-5,8-9,18H,2H3,(H2,15,16,19)/t5-,8?,9-,11?,12?/m1/s1 |
| InChIKey | XXULRIRJBCOFKU-JUANLSGESA-N |
| XLogP | -0.42 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.69 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|