C12H11FN2O6 — CID 163437926
1-[(3R,5R)-4-ethynyl-4-hydroxy-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 163437926) has the molecular formula C12H11FN2O6 and a molecular weight of 298.23 g/mol. Its IUPAC name is 1-[(3R,5R)-4-ethynyl-4-hydroxy-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(3R,5R)-4-ethynyl-4-hydroxy-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163437926 |
| Molecular Formula | C12H11FN2O6 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-[(3R,5R)-4-ethynyl-4-hydroxy-1-[(1R)-1-hydroxyethyl]-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | C#CC1(O)C2OC2([C@@H](C)O)O[C@H]1n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H11FN2O6/c1-3-11(19)8-12(20-8,5(2)16)21-9(11)15-4-6(13)7(17)14-10(15)18/h1,4-5,8-9,16,19H,2H3,(H,14,17,18)/t5-,8?,9-,11?,12?/m1/s1 |
| InChIKey | AWBXOMHZTMUTBW-JUANLSGESA-N |
| XLogP | -1.96 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|