C9H14FNS — CID 145395284
(3Z)-4-fluoro-5-methylidene-N-methylsulfanylhepta-1,3-dien-3-amine (PubChem CID 145395284) has the molecular formula C9H14FNS and a molecular weight of 187.28 g/mol. Its IUPAC name is (3Z)-4-fluoro-5-methylidene-N-methylsulfanylhepta-1,3-dien-3-amine.
| Compound Name | (3Z)-4-fluoro-5-methylidene-N-methylsulfanylhepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 145395284 |
| Molecular Formula | C9H14FNS |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (3Z)-4-fluoro-5-methylidene-N-methylsulfanylhepta-1,3-dien-3-amine |
| SMILES | C=C/C(NSC)=C(/F)C(=C)CC |
| InChI | InChI=1S/C9H14FNS/c1-5-7(3)9(10)8(6-2)11-12-4/h6,11H,2-3,5H2,1,4H3/b9-8- |
| InChIKey | GHTSGNBIMWRTFB-HJWRWDBZSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|