(1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate

C10H14O3 — CID 145395489

IUPAC(1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate
SMILESCC(=O)OC1(C)CCC=C(C)C1=O
InChIInChI=1S/C10H14O3/c1-7-5-4-6-10(3,9(7)12)13-8(2)11/h5H,4,6H2,1-3H3
InChIKeyUTWLIHOORLNESY-UHFFFAOYSA-N
MW182.22 g/mol
LogP1.62
Rot. Bonds1

About (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate

(1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate (PubChem CID 145395489) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate.

Molecular Properties

Compound Name(1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate
PubChem CID145395489
Molecular FormulaC10H14O3
Molecular Weight182.22 g/mol
Exact Mass182.09
IUPAC Name(1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate
SMILESCC(=O)OC1(C)CCC=C(C)C1=O
InChIInChI=1S/C10H14O3/c1-7-5-4-6-10(3,9(7)12)13-8(2)11/h5H,4,6H2,1-3H3
InChIKeyUTWLIHOORLNESY-UHFFFAOYSA-N
XLogP1.62
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 51.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate?
The IUPAC name of (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate (CID 145395489) is (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate.
What is the SMILES notation for (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate?
The canonical SMILES for (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate is CC(=O)OC1(C)CCC=C(C)C1=O.
What is the InChIKey of (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate?
The InChIKey is UTWLIHOORLNESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-7-5-4-6-10(3,9(7)12)13-8(2)11/h5H,4,6H2,1-3H3.
What are the key properties of (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate?
(1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate has a molecular weight of 182.22 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethyl-2-oxocyclohex-3-en-1-yl) acetate is sourced from PubChem (CID 145395489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).