C17H22O4 — CID 162870563
[5-methyl-2-[(2S)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate (PubChem CID 162870563) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [5-methyl-2-[(2S)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate.
| Compound Name | [5-methyl-2-[(2S)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 162870563 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [5-methyl-2-[(2S)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
| SMILES | CC(=O)OC1=C([C@@H](C)CCC=C(C)C)C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C17H22O4/c1-10(2)7-6-8-11(3)15-14(19)9-12(4)16(20)17(15)21-13(5)18/h7,9,11H,6,8H2,1-5H3/t11-/m0/s1 |
| InChIKey | WZPQOPUJQODOBB-NSHDSACASA-N |
| XLogP | 3.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|