C12H27NO — CID 145397022
(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine;ethane (PubChem CID 145397022) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is (3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine;ethane.
| Compound Name | (3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine;ethane |
|---|---|
| PubChem CID | 145397022 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine;ethane |
| SMILES | CC.CC.C[C@@H]1CN2CCC[C@H]2CO1 |
| InChI | InChI=1S/C8H15NO.2C2H6/c1-7-5-9-4-2-3-8(9)6-10-7;2*1-2/h7-8H,2-6H2,1H3;2*1-2H3/t7-,8+;;/m1../s1 |
| InChIKey | ARVWICOZRLDWNA-YUZCMTBUSA-N |
| XLogP | 2.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |