C13H20N2S — CID 145401235
1-but-1-en-2-yl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylthiourea (PubChem CID 145401235) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-but-1-en-2-yl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylthiourea.
| Compound Name | 1-but-1-en-2-yl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 145401235 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-but-1-en-2-yl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methylthiourea |
| SMILES | C=C/C=C\C(=C/C)N(C(=C)CC)C(=S)NC |
| InChI | InChI=1S/C13H20N2S/c1-6-9-10-12(8-3)15(11(4)7-2)13(16)14-5/h6,8-10H,1,4,7H2,2-3,5H3,(H,14,16)/b10-9-,12-8+ |
| InChIKey | RTNZVIUSMJBYDO-XAYCDYAHSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|