C11H15N2S+ — CID 164982728
cyclonona-1,3,5,7-tetraen-1-ylcarbamothioyl(methyl)azanium (PubChem CID 164982728) has the molecular formula C11H15N2S+ and a molecular weight of 207.32 g/mol. Its IUPAC name is cyclonona-1,3,5,7-tetraen-1-ylcarbamothioyl(methyl)azanium.
| Compound Name | cyclonona-1,3,5,7-tetraen-1-ylcarbamothioyl(methyl)azanium |
|---|---|
| PubChem CID | 164982728 |
| Molecular Formula | C11H15N2S+ |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | cyclonona-1,3,5,7-tetraen-1-ylcarbamothioyl(methyl)azanium |
| SMILES | C[NH2+]C(=S)NC1=CC=CC=CC=CC1 |
| InChI | InChI=1S/C11H14N2S/c1-12-11(14)13-10-8-6-4-2-3-5-7-9-10/h2-8H,9H2,1H3,(H2,12,13,14)/p+1 |
| InChIKey | FSKCJDYXWXJRCI-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 28.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|