C11H18N2S — CID 142963951
1-butan-2-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]thiourea (PubChem CID 142963951) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 1-butan-2-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]thiourea.
| Compound Name | 1-butan-2-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]thiourea |
|---|---|
| PubChem CID | 142963951 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-butan-2-yl-3-[(3E)-hexa-1,3,5-trien-3-yl]thiourea |
| SMILES | C=C/C=C(\C=C)NC(=S)NC(C)CC |
| InChI | InChI=1S/C11H18N2S/c1-5-8-10(7-3)13-11(14)12-9(4)6-2/h5,7-9H,1,3,6H2,2,4H3,(H2,12,13,14)/b10-8+ |
| InChIKey | CGWUFZGRKKKWRP-CSKARUKUSA-N |
| XLogP | 2.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|