C6H8N2S — CID 91598375
4-[(E)-prop-1-enyl]-1,3-dihydroimidazole-2-thione (PubChem CID 91598375) has the molecular formula C6H8N2S and a molecular weight of 140.21 g/mol. Its IUPAC name is 4-[(E)-prop-1-enyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(E)-prop-1-enyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 91598375 |
| Molecular Formula | C6H8N2S |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 4-[(E)-prop-1-enyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C/C=C/c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C6H8N2S/c1-2-3-5-4-7-6(9)8-5/h2-4H,1H3,(H2,7,8,9)/b3-2+ |
| InChIKey | XNAPEQMTUPEOMM-NSCUHMNNSA-N |
| XLogP | 2.11 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|