C4H6N2S — CID 2759857
4-methyl-1,3-dihydroimidazole-2-thione (PubChem CID 2759857) has the molecular formula C4H6N2S and a molecular weight of 114.17 g/mol. Its IUPAC name is 4-methyl-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-methyl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 2759857 |
| Molecular Formula | C4H6N2S |
| Molecular Weight | 114.17 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 4-methyl-1,3-dihydroimidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C4H6N2S/c1-3-2-5-4(7)6-3/h2H,1H3,(H2,5,6,7) |
| InChIKey | SBQPDLGIWJRKBS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|