C12H23NO — CID 145401691
ethane;N-methyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethanamine (PubChem CID 145401691) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;N-methyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethanamine.
| Compound Name | ethane;N-methyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethanamine |
|---|---|
| PubChem CID | 145401691 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;N-methyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethanamine |
| SMILES | C=C(C)/C=C\C(=C)OCCNC.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-9(2)5-6-10(3)12-8-7-11-4;1-2/h5-6,11H,1,3,7-8H2,2,4H3;1-2H3/b6-5-; |
| InChIKey | XMDXCTDZBBVPCP-YSMBQZINSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|