C7H10N4S — CID 145410697
(E)-N'-(3-methyl-1,2,4-thiadiazol-5-yl)but-2-enimidamide (PubChem CID 145410697) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is (E)-N'-(3-methyl-1,2,4-thiadiazol-5-yl)but-2-enimidamide.
| Compound Name | (E)-N'-(3-methyl-1,2,4-thiadiazol-5-yl)but-2-enimidamide |
|---|---|
| PubChem CID | 145410697 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (E)-N'-(3-methyl-1,2,4-thiadiazol-5-yl)but-2-enimidamide |
| SMILES | C/C=C/C(N)=N\c1nc(C)ns1 |
| InChI | InChI=1S/C7H10N4S/c1-3-4-6(8)10-7-9-5(2)11-12-7/h3-4H,1-2H3,(H2,8,9,10,11)/b4-3+ |
| InChIKey | UZXPTSWBCQERJW-ONEGZZNKSA-N |
| XLogP | 1.41 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|