C12H21N3 — CID 145412730
ethane;(2Z,5Z)-3-ethenyl-4-imino-2-methylhepta-2,5-dienimidamide (PubChem CID 145412730) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;(2Z,5Z)-3-ethenyl-4-imino-2-methylhepta-2,5-dienimidamide.
| Compound Name | ethane;(2Z,5Z)-3-ethenyl-4-imino-2-methylhepta-2,5-dienimidamide |
|---|---|
| PubChem CID | 145412730 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;(2Z,5Z)-3-ethenyl-4-imino-2-methylhepta-2,5-dienimidamide |
| SMILES | CC.[H]N=C(C=CC)/C(C=C)=C(C)\C(N)=N\[H] |
| InChI | InChI=1S/C10H15N3.C2H6/c1-4-6-9(11)8(5-2)7(3)10(12)13;1-2/h4-6,11H,2H2,1,3H3,(H3,12,13);1-2H3/b6-4-,8-7-,11-9+; |
| InChIKey | YHGVJSMOBXVTQA-UVPRZULUSA-N |
| XLogP | 3.05 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|