C28H33NO5 — CID 14541410
[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanamine (PubChem CID 14541410) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is [6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanamine.
| Compound Name | [6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 14541410 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | [6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanamine |
| SMILES | COC1OC(CN)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C28H33NO5/c1-30-28-27(33-20-23-15-9-4-10-16-23)26(32-19-22-13-7-3-8-14-22)25(24(17-29)34-28)31-18-21-11-5-2-6-12-21/h2-16,24-28H,17-20,29H2,1H3 |
| InChIKey | IGIHLLRSHTZZPN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |