C15H20N2O6 — CID 145415097
6-(2,5-dioxopyrrol-1-yl)hexanal;1-methoxypyrrolidine-2,5-dione (PubChem CID 145415097) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanal;1-methoxypyrrolidine-2,5-dione.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanal;1-methoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 145415097 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanal;1-methoxypyrrolidine-2,5-dione |
| SMILES | CON1C(=O)CCC1=O.O=CCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13NO3.C5H7NO3/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14;1-9-6-4(7)2-3-5(6)8/h5-6,8H,1-4,7H2;2-3H2,1H3 |
| InChIKey | FCIPSZMGZLYYMO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|