C16H17ClN3O2P — CID 145416559
6-[[(2E)-3-chloro-4-methyl-2-(1-phosphanylethenyl)penta-2,4-dienyl]amino]imidazo[1,2-a]pyridine-5-carboxylic acid (PubChem CID 145416559) has the molecular formula C16H17ClN3O2P and a molecular weight of 349.76 g/mol. Its IUPAC name is 6-[[(2E)-3-chloro-4-methyl-2-(1-phosphanylethenyl)penta-2,4-dienyl]amino]imidazo[1,2-a]pyridine-5-carboxylic acid.
| Compound Name | 6-[[(2E)-3-chloro-4-methyl-2-(1-phosphanylethenyl)penta-2,4-dienyl]amino]imidazo[1,2-a]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 145416559 |
| Molecular Formula | C16H17ClN3O2P |
| Molecular Weight | 349.76 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 6-[[(2E)-3-chloro-4-methyl-2-(1-phosphanylethenyl)penta-2,4-dienyl]amino]imidazo[1,2-a]pyridine-5-carboxylic acid |
| SMILES | C=C(C)/C(Cl)=C(/CNc1ccc2nccn2c1C(=O)O)C(=C)P |
| InChI | InChI=1S/C16H17ClN3O2P/c1-9(2)14(17)11(10(3)23)8-19-12-4-5-13-18-6-7-20(13)15(12)16(21)22/h4-7,19H,1,3,8,23H2,2H3,(H,21,22)/b14-11+ |
| InChIKey | PLAHVFRAJKQPEN-SDNWHVSQSA-N |
| XLogP | 3.90 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|