C55H55NO — CID 145421749
1,1-diphenylethanamine;ethane;(2Z,5Z,7Z)-9-methylidene-2-[4-[(1E,3E)-1-[3-(3-methylphenyl)phenyl]-1-phenylpenta-1,3-dien-3-yl]phenyl]-4H-oxonine (PubChem CID 145421749) has the molecular formula C55H55NO and a molecular weight of 746.05 g/mol. Its IUPAC name is 1,1-diphenylethanamine;ethane;(2Z,5Z,7Z)-9-methylidene-2-[4-[(1E,3E)-1-[3-(3-methylphenyl)phenyl]-1-phenylpenta-1,3-dien-3-yl]phenyl]-4H-oxonine.
| Compound Name | 1,1-diphenylethanamine;ethane;(2Z,5Z,7Z)-9-methylidene-2-[4-[(1E,3E)-1-[3-(3-methylphenyl)phenyl]-1-phenylpenta-1,3-dien-3-yl]phenyl]-4H-oxonine |
|---|---|
| PubChem CID | 145421749 |
| Molecular Formula | C55H55NO |
| Molecular Weight | 746.05 g/mol |
| Exact Mass | 745.43 |
| IUPAC Name | 1,1-diphenylethanamine;ethane;(2Z,5Z,7Z)-9-methylidene-2-[4-[(1E,3E)-1-[3-(3-methylphenyl)phenyl]-1-phenylpenta-1,3-dien-3-yl]phenyl]-4H-oxonine |
| SMILES | C=C1/C=C\C=C/C/C=C(/c2ccc(C(=C/C)/C=C(\c3ccccc3)c3cccc(-c4cccc(C)c4)c3)cc2)O1.CC.CC(N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H34O.C14H15N.C2H6/c1-4-31(32-22-24-34(25-23-32)39-21-11-6-5-8-15-30(3)40-39)28-38(33-16-9-7-10-17-33)37-20-13-19-36(27-37)35-18-12-14-29(2)26-35;1-14(15,12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2/h4-10,12-28H,3,11H2,1-2H3;2-11H,15H2,1H3;1-2H3/b6-5-,15-8-,31-4+,38-28+,39-21-;; |
| InChIKey | BIGRXRWPJQFVRS-STIIQSAVSA-N |
| XLogP | 14.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.05 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|